C14H27BrN2O4 — CID 91601633
tert-butyl N-[(2R)-1-(2-bromoethoxycarbonylamino)-3,3-dimethylbutan-2-yl]carbamate (PubChem CID 91601633) has the molecular formula C14H27BrN2O4 and a molecular weight of 367.28 g/mol. Its IUPAC name is tert-butyl N-[(2R)-1-(2-bromoethoxycarbonylamino)-3,3-dimethylbutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R)-1-(2-bromoethoxycarbonylamino)-3,3-dimethylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 91601633 |
| Molecular Formula | C14H27BrN2O4 |
| Molecular Weight | 367.28 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | tert-butyl N-[(2R)-1-(2-bromoethoxycarbonylamino)-3,3-dimethylbutan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CNC(=O)OCCBr)C(C)(C)C |
| InChI | InChI=1S/C14H27BrN2O4/c1-13(2,3)10(9-16-11(18)20-8-7-15)17-12(19)21-14(4,5)6/h10H,7-9H2,1-6H3,(H,16,18)(H,17,19)/t10-/m0/s1 |
| InChIKey | LVALJKCITAGAHF-JTQLQIEISA-N |
| XLogP | 3.05 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.28 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|