C25H31F3N6O2 — CID 91603302
4-[2-cyanoimino-3,3-dimethyl-4-[[5-(trifluoromethyl)-2-pyridinyl]oxymethyl]pyrrolidin-1-yl]-N'-hydroxyadamantane-1-carboximidamide (PubChem CID 91603302) has the molecular formula C25H31F3N6O2 and a molecular weight of 504.56 g/mol. Its IUPAC name is 4-[2-cyanoimino-3,3-dimethyl-4-[[5-(trifluoromethyl)-2-pyridinyl]oxymethyl]pyrrolidin-1-yl]-N'-hydroxyadamantane-1-carboximidamide.
| Compound Name | 4-[2-cyanoimino-3,3-dimethyl-4-[[5-(trifluoromethyl)-2-pyridinyl]oxymethyl]pyrrolidin-1-yl]-N'-hydroxyadamantane-1-carboximidamide |
|---|---|
| PubChem CID | 91603302 |
| Molecular Formula | C25H31F3N6O2 |
| Molecular Weight | 504.56 g/mol |
| Exact Mass | 504.25 |
| IUPAC Name | 4-[2-cyanoimino-3,3-dimethyl-4-[[5-(trifluoromethyl)-2-pyridinyl]oxymethyl]pyrrolidin-1-yl]-N'-hydroxyadamantane-1-carboximidamide |
| SMILES | CC1(C)/C(=N\C#N)N(C2C3CC4CC2CC(C(N)=NO)(C4)C3)CC1COc1ccc(C(F)(F)F)cn1 |
| InChI | InChI=1S/C25H31F3N6O2/c1-23(2)18(12-36-19-4-3-17(10-31-19)25(26,27)28)11-34(22(23)32-13-29)20-15-5-14-6-16(20)9-24(7-14,8-15)21(30)33-35/h3-4,10,14-16,18,20,35H,5-9,11-12H2,1-2H3,(H2,30,33)/b32-22+ |
| InChIKey | JVASILYLTJABHE-WEMUVCOSSA-N |
| XLogP | 4.26 |
| TPSA | 120.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.56 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|