C25H30F3N5O2 — CID 172787175
N-[2-cyanoimino-3,3-dimethyl-4-[[5-(trifluoromethyl)-2-pyridinyl]oxymethyl]pyrrolidin-1-yl]adamantane-1-carboxamide (PubChem CID 172787175) has the molecular formula C25H30F3N5O2 and a molecular weight of 489.54 g/mol. Its IUPAC name is N-[2-cyanoimino-3,3-dimethyl-4-[[5-(trifluoromethyl)-2-pyridinyl]oxymethyl]pyrrolidin-1-yl]adamantane-1-carboxamide.
| Compound Name | N-[2-cyanoimino-3,3-dimethyl-4-[[5-(trifluoromethyl)-2-pyridinyl]oxymethyl]pyrrolidin-1-yl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 172787175 |
| Molecular Formula | C25H30F3N5O2 |
| Molecular Weight | 489.54 g/mol |
| Exact Mass | 489.24 |
| IUPAC Name | N-[2-cyanoimino-3,3-dimethyl-4-[[5-(trifluoromethyl)-2-pyridinyl]oxymethyl]pyrrolidin-1-yl]adamantane-1-carboxamide |
| SMILES | CC1(C)/C(=N\C#N)N(NC(=O)C23CC4CC(CC(C4)C2)C3)CC1COc1ccc(C(F)(F)F)cn1 |
| InChI | InChI=1S/C25H30F3N5O2/c1-23(2)19(13-35-20-4-3-18(11-30-20)25(26,27)28)12-33(21(23)31-14-29)32-22(34)24-8-15-5-16(9-24)7-17(6-15)10-24/h3-4,11,15-17,19H,5-10,12-13H2,1-2H3,(H,32,34)/b31-21+ |
| InChIKey | PBDSMIFMLXJEQH-NJZRLIGZSA-N |
| XLogP | 4.56 |
| TPSA | 90.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.54 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|