C24H38BNO5 — CID 91605429
tert-butyl 6-[4-(3,3-dimethylbutyl)-4,5,5-trimethyl-1,3,2-dioxaborolan-2-yl]-2,3-dihydro-1,4-benzoxazine-4-carboxylate (PubChem CID 91605429) has the molecular formula C24H38BNO5 and a molecular weight of 431.38 g/mol. Its IUPAC name is tert-butyl 6-[4-(3,3-dimethylbutyl)-4,5,5-trimethyl-1,3,2-dioxaborolan-2-yl]-2,3-dihydro-1,4-benzoxazine-4-carboxylate.
| Compound Name | tert-butyl 6-[4-(3,3-dimethylbutyl)-4,5,5-trimethyl-1,3,2-dioxaborolan-2-yl]-2,3-dihydro-1,4-benzoxazine-4-carboxylate |
|---|---|
| PubChem CID | 91605429 |
| Molecular Formula | C24H38BNO5 |
| Molecular Weight | 431.38 g/mol |
| Exact Mass | 431.28 |
| IUPAC Name | tert-butyl 6-[4-(3,3-dimethylbutyl)-4,5,5-trimethyl-1,3,2-dioxaborolan-2-yl]-2,3-dihydro-1,4-benzoxazine-4-carboxylate |
| SMILES | CC(C)(C)CCC1(C)OB(c2ccc3c(c2)N(C(=O)OC(C)(C)C)CCO3)OC1(C)C |
| InChI | InChI=1S/C24H38BNO5/c1-21(2,3)12-13-24(9)23(7,8)30-25(31-24)17-10-11-19-18(16-17)26(14-15-28-19)20(27)29-22(4,5)6/h10-11,16H,12-15H2,1-9H3 |
| InChIKey | SNDYUALVYMJLQY-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.38 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|