C58H97N5O6 — CID 91607785
2-(benzotriazol-2-yl)-4,6-dimethylphenol;(2,2,6,6-tetramethyl-1-octoxypiperidin-4-yl) 10-oxo-10-(3,3,5,5-tetramethyl-4-octoxypiperidin-1-yl)decanoate (PubChem CID 91607785) has the molecular formula C58H97N5O6 and a molecular weight of 960.44 g/mol. Its IUPAC name is 2-(benzotriazol-2-yl)-4,6-dimethylphenol;(2,2,6,6-tetramethyl-1-octoxypiperidin-4-yl) 10-oxo-10-(3,3,5,5-tetramethyl-4-octoxypiperidin-1-yl)decanoate.
| Compound Name | 2-(benzotriazol-2-yl)-4,6-dimethylphenol;(2,2,6,6-tetramethyl-1-octoxypiperidin-4-yl) 10-oxo-10-(3,3,5,5-tetramethyl-4-octoxypiperidin-1-yl)decanoate |
|---|---|
| PubChem CID | 91607785 |
| Molecular Formula | C58H97N5O6 |
| Molecular Weight | 960.44 g/mol |
| Exact Mass | 959.74 |
| IUPAC Name | 2-(benzotriazol-2-yl)-4,6-dimethylphenol;(2,2,6,6-tetramethyl-1-octoxypiperidin-4-yl) 10-oxo-10-(3,3,5,5-tetramethyl-4-octoxypiperidin-1-yl)decanoate |
| SMILES | CCCCCCCCOC1C(C)(C)CN(C(=O)CCCCCCCCC(=O)OC2CC(C)(C)N(OCCCCCCCC)C(C)(C)C2)CC1(C)C.Cc1cc(C)c(O)c(-n2nc3ccccc3n2)c1 |
| InChI | InChI=1S/C44H84N2O5.C14H13N3O/c1-11-13-15-17-23-27-31-49-40-41(3,4)35-45(36-42(40,5)6)38(47)29-25-21-19-20-22-26-30-39(48)51-37-33-43(7,8)46(44(9,10)34-37)50-32-28-24-18-16-14-12-2;1-9-7-10(2)14(18)13(8-9)17-15-11-5-3-4-6-12(11)16-17/h37,40H,11-36H2,1-10H3;3-8,18H,1-2H3 |
| InChIKey | XAUFKEXXQMPRGI-UHFFFAOYSA-N |
| XLogP | 14.35 |
| TPSA | 119.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 960.44 |
| LogP ≤ 5 | 14.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|