C11H10ClN3S — CID 91620777
5-(3-chlorophenyl)-N-prop-2-enyl-1,3,4-thiadiazol-2-amine (PubChem CID 91620777) has the molecular formula C11H10ClN3S and a molecular weight of 251.74 g/mol. Its IUPAC name is 5-(3-chlorophenyl)-N-prop-2-enyl-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-(3-chlorophenyl)-N-prop-2-enyl-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 91620777 |
| Molecular Formula | C11H10ClN3S |
| Molecular Weight | 251.74 g/mol |
| Exact Mass | 251.03 |
| IUPAC Name | 5-(3-chlorophenyl)-N-prop-2-enyl-1,3,4-thiadiazol-2-amine |
| SMILES | C=CCNc1nnc(-c2cccc(Cl)c2)s1 |
| InChI | InChI=1S/C11H10ClN3S/c1-2-6-13-11-15-14-10(16-11)8-4-3-5-9(12)7-8/h2-5,7H,1,6H2,(H,13,15) |
| InChIKey | QQAXTEPYLRPLSZ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.74 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|