C11H11BrN2OS — CID 91622717
1-(3-bromophenyl)-2-(2-imino-1,3-thiazolidin-3-yl)ethanone (PubChem CID 91622717) has the molecular formula C11H11BrN2OS and a molecular weight of 299.19 g/mol. Its IUPAC name is 1-(3-bromophenyl)-2-(2-imino-1,3-thiazolidin-3-yl)ethanone.
| Compound Name | 1-(3-bromophenyl)-2-(2-imino-1,3-thiazolidin-3-yl)ethanone |
|---|---|
| PubChem CID | 91622717 |
| Molecular Formula | C11H11BrN2OS |
| Molecular Weight | 299.19 g/mol |
| Exact Mass | 297.98 |
| IUPAC Name | 1-(3-bromophenyl)-2-(2-imino-1,3-thiazolidin-3-yl)ethanone |
| SMILES | [H]/N=C1\SCCN1CC(=O)c1cccc(Br)c1 |
| InChI | InChI=1S/C11H11BrN2OS/c12-9-3-1-2-8(6-9)10(15)7-14-4-5-16-11(14)13/h1-3,6,13H,4-5,7H2/b13-11- |
| InChIKey | SIVCPATXICONBJ-QBFSEMIESA-N |
| XLogP | 2.62 |
| TPSA | 44.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.19 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|