C15H16FN5O2 — CID 91650465
N-[(4,5-dicyclopropyl-1,2,4-triazol-3-yl)methyl]-3-fluoro-2-nitroaniline (PubChem CID 91650465) has the molecular formula C15H16FN5O2 and a molecular weight of 317.32 g/mol. Its IUPAC name is N-[(4,5-dicyclopropyl-1,2,4-triazol-3-yl)methyl]-3-fluoro-2-nitroaniline.
| Compound Name | N-[(4,5-dicyclopropyl-1,2,4-triazol-3-yl)methyl]-3-fluoro-2-nitroaniline |
|---|---|
| PubChem CID | 91650465 |
| Molecular Formula | C15H16FN5O2 |
| Molecular Weight | 317.32 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | N-[(4,5-dicyclopropyl-1,2,4-triazol-3-yl)methyl]-3-fluoro-2-nitroaniline |
| SMILES | O=[N+]([O-])c1c(F)cccc1NCc1nnc(C2CC2)n1C1CC1 |
| InChI | InChI=1S/C15H16FN5O2/c16-11-2-1-3-12(14(11)21(22)23)17-8-13-18-19-15(9-4-5-9)20(13)10-6-7-10/h1-3,9-10,17H,4-8H2 |
| InChIKey | PKCICKMLIGDBKE-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 85.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.32 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|