C17H21BF3N2O3S- — CID 91667289
[4-[5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentoxy]benzoyl]-trifluoroboranuide (PubChem CID 91667289) has the molecular formula C17H21BF3N2O3S- and a molecular weight of 401.24 g/mol. Its IUPAC name is [4-[5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentoxy]benzoyl]-trifluoroboranuide.
| Compound Name | [4-[5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentoxy]benzoyl]-trifluoroboranuide |
|---|---|
| PubChem CID | 91667289 |
| Molecular Formula | C17H21BF3N2O3S- |
| Molecular Weight | 401.24 g/mol |
| Exact Mass | 401.13 |
| IUPAC Name | [4-[5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentoxy]benzoyl]-trifluoroboranuide |
| SMILES | O=C1N[C@H]2[C@H](CS[C@H]2CCCCCOc2ccc(C(=O)[B-](F)(F)F)cc2)N1 |
| InChI | InChI=1S/C17H21BF3N2O3S/c19-18(20,21)16(24)11-5-7-12(8-6-11)26-9-3-1-2-4-14-15-13(10-27-14)22-17(25)23-15/h5-8,13-15H,1-4,9-10H2,(H2,22,23,25)/q-1/t13-,14-,15-/m0/s1 |
| InChIKey | NKKKFKQVHLHMIZ-KKUMJFAQSA-N |
| XLogP | 3.36 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.24 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|