C23H34O3S — CID 91667404
(7E,9S,11Z,14Z,17Z,20Z)-5-oxo-9-sulfanyltricosa-7,11,14,17,20-pentaenoic acid (PubChem CID 91667404) has the molecular formula C23H34O3S and a molecular weight of 390.59 g/mol. Its IUPAC name is (7E,9S,11Z,14Z,17Z,20Z)-5-oxo-9-sulfanyltricosa-7,11,14,17,20-pentaenoic acid.
| Compound Name | (7E,9S,11Z,14Z,17Z,20Z)-5-oxo-9-sulfanyltricosa-7,11,14,17,20-pentaenoic acid |
|---|---|
| PubChem CID | 91667404 |
| Molecular Formula | C23H34O3S |
| Molecular Weight | 390.59 g/mol |
| Exact Mass | 390.22 |
| IUPAC Name | (7E,9S,11Z,14Z,17Z,20Z)-5-oxo-9-sulfanyltricosa-7,11,14,17,20-pentaenoic acid |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C[C@H](S)/C=C/CC(=O)CCCC(=O)O |
| InChI | InChI=1S/C23H34O3S/c1-2-3-4-5-6-7-8-9-10-11-12-13-18-22(27)19-14-16-21(24)17-15-20-23(25)26/h3-4,6-7,9-10,12-14,19,22,27H,2,5,8,11,15-18,20H2,1H3,(H,25,26)/b4-3-,7-6-,10-9-,13-12-,19-14+/t22-/m0/s1 |
| InChIKey | LOZHXIYGVBRZNN-OGNFQFBJSA-N |
| XLogP | 6.25 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.59 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|