C14H17N3O3 — CID 91673292
3-methyl-1-(7-nitro-2,3-dihydro-1,4-benzodiazepin-1-yl)butan-1-one (PubChem CID 91673292) has the molecular formula C14H17N3O3 and a molecular weight of 275.31 g/mol. Its IUPAC name is 3-methyl-1-(7-nitro-2,3-dihydro-1,4-benzodiazepin-1-yl)butan-1-one.
| Compound Name | 3-methyl-1-(7-nitro-2,3-dihydro-1,4-benzodiazepin-1-yl)butan-1-one |
|---|---|
| PubChem CID | 91673292 |
| Molecular Formula | C14H17N3O3 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | 3-methyl-1-(7-nitro-2,3-dihydro-1,4-benzodiazepin-1-yl)butan-1-one |
| SMILES | CC(C)CC(=O)N1CCN=Cc2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C14H17N3O3/c1-10(2)7-14(18)16-6-5-15-9-11-8-12(17(19)20)3-4-13(11)16/h3-4,8-10H,5-7H2,1-2H3 |
| InChIKey | UBJUDROIVDIPHG-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 75.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|