C11H8N4O3 — CID 91496260
8-nitro-2,4-dihydroimidazo[1,2-a][1,4]benzodiazepin-1-one (PubChem CID 91496260) has the molecular formula C11H8N4O3 and a molecular weight of 244.21 g/mol. Its IUPAC name is 8-nitro-2,4-dihydroimidazo[1,2-a][1,4]benzodiazepin-1-one.
| Compound Name | 8-nitro-2,4-dihydroimidazo[1,2-a][1,4]benzodiazepin-1-one |
|---|---|
| PubChem CID | 91496260 |
| Molecular Formula | C11H8N4O3 |
| Molecular Weight | 244.21 g/mol |
| Exact Mass | 244.06 |
| IUPAC Name | 8-nitro-2,4-dihydroimidazo[1,2-a][1,4]benzodiazepin-1-one |
| SMILES | O=C1CN=C2CN=Cc3cc([N+](=O)[O-])ccc3N12 |
| InChI | InChI=1S/C11H8N4O3/c16-11-6-13-10-5-12-4-7-3-8(15(17)18)1-2-9(7)14(10)11/h1-4H,5-6H2 |
| InChIKey | RPULYYGAFHSHNV-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 88.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.21 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|