C22H21N5S — CID 91675222
6-(1-benzyl-3,6-dihydro-2H-pyridin-4-yl)-3-(4-methylphenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole (PubChem CID 91675222) has the molecular formula C22H21N5S and a molecular weight of 387.51 g/mol. Its IUPAC name is 6-(1-benzyl-3,6-dihydro-2H-pyridin-4-yl)-3-(4-methylphenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole.
| Compound Name | 6-(1-benzyl-3,6-dihydro-2H-pyridin-4-yl)-3-(4-methylphenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
|---|---|
| PubChem CID | 91675222 |
| Molecular Formula | C22H21N5S |
| Molecular Weight | 387.51 g/mol |
| Exact Mass | 387.15 |
| IUPAC Name | 6-(1-benzyl-3,6-dihydro-2H-pyridin-4-yl)-3-(4-methylphenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
| SMILES | Cc1ccc(-c2nnc3sc(C4=CCN(Cc5ccccc5)CC4)nn23)cc1 |
| InChI | InChI=1S/C22H21N5S/c1-16-7-9-18(10-8-16)20-23-24-22-27(20)25-21(28-22)19-11-13-26(14-12-19)15-17-5-3-2-4-6-17/h2-11H,12-15H2,1H3 |
| InChIKey | RHMDMWLLRIGQOZ-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 46.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.51 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |