C17H12Cl2IN3O2 — CID 91685463
5-[(E)-2-[4-[(3,4-dichlorophenyl)methoxy]-3-iodophenyl]ethenyl]-1,3,4-oxadiazol-2-amine (PubChem CID 91685463) has the molecular formula C17H12Cl2IN3O2 and a molecular weight of 488.11 g/mol. Its IUPAC name is 5-[(E)-2-[4-[(3,4-dichlorophenyl)methoxy]-3-iodophenyl]ethenyl]-1,3,4-oxadiazol-2-amine.
| Compound Name | 5-[(E)-2-[4-[(3,4-dichlorophenyl)methoxy]-3-iodophenyl]ethenyl]-1,3,4-oxadiazol-2-amine |
|---|---|
| PubChem CID | 91685463 |
| Molecular Formula | C17H12Cl2IN3O2 |
| Molecular Weight | 488.11 g/mol |
| Exact Mass | 486.94 |
| IUPAC Name | 5-[(E)-2-[4-[(3,4-dichlorophenyl)methoxy]-3-iodophenyl]ethenyl]-1,3,4-oxadiazol-2-amine |
| SMILES | Nc1nnc(/C=C/c2ccc(OCc3ccc(Cl)c(Cl)c3)c(I)c2)o1 |
| InChI | InChI=1S/C17H12Cl2IN3O2/c18-12-4-1-11(7-13(12)19)9-24-15-5-2-10(8-14(15)20)3-6-16-22-23-17(21)25-16/h1-8H,9H2,(H2,21,23)/b6-3+ |
| InChIKey | ZBNBSVWLFUDZKA-ZZXKWVIFSA-N |
| XLogP | 5.31 |
| TPSA | 74.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.11 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|