C4HBrF8O — CID 91694741
1-bromo-1,1,2,2-tetrafluoro-2-(1,1,2,2-tetrafluoroethoxy)ethane (PubChem CID 91694741) has the molecular formula C4HBrF8O and a molecular weight of 296.94 g/mol. Its IUPAC name is 1-bromo-1,1,2,2-tetrafluoro-2-(1,1,2,2-tetrafluoroethoxy)ethane.
| Compound Name | 1-bromo-1,1,2,2-tetrafluoro-2-(1,1,2,2-tetrafluoroethoxy)ethane |
|---|---|
| PubChem CID | 91694741 |
| Molecular Formula | C4HBrF8O |
| Molecular Weight | 296.94 g/mol |
| Exact Mass | 295.91 |
| IUPAC Name | 1-bromo-1,1,2,2-tetrafluoro-2-(1,1,2,2-tetrafluoroethoxy)ethane |
| SMILES | FC(F)C(F)(F)OC(F)(F)C(F)(F)Br |
| InChI | InChI=1S/C4HBrF8O/c5-3(10,11)4(12,13)14-2(8,9)1(6)7/h1H |
| InChIKey | ROVZGEWCLKGWIX-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.94 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|