C32H56O2Si — CID 91694866
dimethyl-bis[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienoxy]silane (PubChem CID 91694866) has the molecular formula C32H56O2Si and a molecular weight of 500.88 g/mol. Its IUPAC name is dimethyl-bis[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienoxy]silane.
| Compound Name | dimethyl-bis[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienoxy]silane |
|---|---|
| PubChem CID | 91694866 |
| Molecular Formula | C32H56O2Si |
| Molecular Weight | 500.88 g/mol |
| Exact Mass | 500.40 |
| IUPAC Name | dimethyl-bis[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienoxy]silane |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CO[Si](C)(C)OC/C=C(\C)CC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C32H56O2Si/c1-27(2)15-11-17-29(5)19-13-21-31(7)23-25-33-35(9,10)34-26-24-32(8)22-14-20-30(6)18-12-16-28(3)4/h15-16,19-20,23-24H,11-14,17-18,21-22,25-26H2,1-10H3/b29-19+,30-20+,31-23+,32-24+ |
| InChIKey | JHBSQBMUJVYJCM-UDUBSFCQSA-N |
| XLogP | 10.56 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.88 |
| LogP ≤ 5 | 10.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|