C24H61O9PSi6 — CID 91696782
[(2R,3S,4S,5R)-3,4,5,6-tetrakis(trimethylsilyloxy)oxan-2-yl]methyl bis(trimethylsilyl) phosphate (PubChem CID 91696782) has the molecular formula C24H61O9PSi6 and a molecular weight of 693.23 g/mol. Its IUPAC name is [(2R,3S,4S,5R)-3,4,5,6-tetrakis(trimethylsilyloxy)oxan-2-yl]methyl bis(trimethylsilyl) phosphate.
| Compound Name | [(2R,3S,4S,5R)-3,4,5,6-tetrakis(trimethylsilyloxy)oxan-2-yl]methyl bis(trimethylsilyl) phosphate |
|---|---|
| PubChem CID | 91696782 |
| Molecular Formula | C24H61O9PSi6 |
| Molecular Weight | 693.23 g/mol |
| Exact Mass | 692.27 |
| IUPAC Name | [(2R,3S,4S,5R)-3,4,5,6-tetrakis(trimethylsilyloxy)oxan-2-yl]methyl bis(trimethylsilyl) phosphate |
| SMILES | C[Si](C)(C)OC1O[C@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C |
| InChI | InChI=1S/C24H61O9PSi6/c1-35(2,3)28-21-20(19-26-34(25,32-39(13,14)15)33-40(16,17)18)27-24(31-38(10,11)12)23(30-37(7,8)9)22(21)29-36(4,5)6/h20-24H,19H2,1-18H3/t20-,21+,22+,23-,24?/m1/s1 |
| InChIKey | CUWCCCIOWKKBTD-CYSUJIKDSA-N |
| XLogP | 8.05 |
| TPSA | 90.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.23 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|