C21H53O8PSi5 — CID 553822
bis(trimethylsilyl) [3,4,6-tris(trimethylsilyloxy)oxan-2-yl]methyl phosphate (PubChem CID 553822) has the molecular formula C21H53O8PSi5 and a molecular weight of 605.05 g/mol. Its IUPAC name is bis(trimethylsilyl) [3,4,6-tris(trimethylsilyloxy)oxan-2-yl]methyl phosphate.
| Compound Name | bis(trimethylsilyl) [3,4,6-tris(trimethylsilyloxy)oxan-2-yl]methyl phosphate |
|---|---|
| PubChem CID | 553822 |
| Molecular Formula | C21H53O8PSi5 |
| Molecular Weight | 605.05 g/mol |
| Exact Mass | 604.23 |
| IUPAC Name | bis(trimethylsilyl) [3,4,6-tris(trimethylsilyloxy)oxan-2-yl]methyl phosphate |
| SMILES | C[Si](C)(C)OC1CC(O[Si](C)(C)C)C(O[Si](C)(C)C)C(COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O1 |
| InChI | InChI=1S/C21H53O8PSi5/c1-31(2,3)25-18-16-20(26-32(4,5)6)24-19(21(18)27-33(7,8)9)17-23-30(22,28-34(10,11)12)29-35(13,14)15/h18-21H,16-17H2,1-15H3 |
| InChIKey | MTXKDBAPCUPMQV-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 81.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.05 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|