C14H34O4Si3 — CID 6427856
trimethyl-[(2R,3S,5S)-5-trimethylsilyloxy-2-(trimethylsilyloxymethyl)oxolan-3-yl]oxysilane (PubChem CID 6427856) has the molecular formula C14H34O4Si3 and a molecular weight of 350.68 g/mol. Its IUPAC name is trimethyl-[(2R,3S,5S)-5-trimethylsilyloxy-2-(trimethylsilyloxymethyl)oxolan-3-yl]oxysilane.
| Compound Name | trimethyl-[(2R,3S,5S)-5-trimethylsilyloxy-2-(trimethylsilyloxymethyl)oxolan-3-yl]oxysilane |
|---|---|
| PubChem CID | 6427856 |
| Molecular Formula | C14H34O4Si3 |
| Molecular Weight | 350.68 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | trimethyl-[(2R,3S,5S)-5-trimethylsilyloxy-2-(trimethylsilyloxymethyl)oxolan-3-yl]oxysilane |
| SMILES | C[Si](C)(C)OC[C@H]1O[C@@H](O[Si](C)(C)C)C[C@@H]1O[Si](C)(C)C |
| InChI | InChI=1S/C14H34O4Si3/c1-19(2,3)15-11-13-12(17-20(4,5)6)10-14(16-13)18-21(7,8)9/h12-14H,10-11H2,1-9H3/t12-,13+,14-/m0/s1 |
| InChIKey | BTOQHYLAKILOAR-MJBXVCDLSA-N |
| XLogP | 4.02 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.68 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|