C19H39NO6Si3 — CID 11730245
1-[(2S,4R,5R,6R)-4,5-bis(trimethylsilyloxy)-6-(trimethylsilyloxymethyl)oxan-2-yl]pyrrolidine-2,5-dione (PubChem CID 11730245) has the molecular formula C19H39NO6Si3 and a molecular weight of 461.78 g/mol. Its IUPAC name is 1-[(2S,4R,5R,6R)-4,5-bis(trimethylsilyloxy)-6-(trimethylsilyloxymethyl)oxan-2-yl]pyrrolidine-2,5-dione.
| Compound Name | 1-[(2S,4R,5R,6R)-4,5-bis(trimethylsilyloxy)-6-(trimethylsilyloxymethyl)oxan-2-yl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 11730245 |
| Molecular Formula | C19H39NO6Si3 |
| Molecular Weight | 461.78 g/mol |
| Exact Mass | 461.21 |
| IUPAC Name | 1-[(2S,4R,5R,6R)-4,5-bis(trimethylsilyloxy)-6-(trimethylsilyloxymethyl)oxan-2-yl]pyrrolidine-2,5-dione |
| SMILES | C[Si](C)(C)OC[C@H]1O[C@H](N2C(=O)CCC2=O)C[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C |
| InChI | InChI=1S/C19H39NO6Si3/c1-27(2,3)23-13-15-19(26-29(7,8)9)14(25-28(4,5)6)12-18(24-15)20-16(21)10-11-17(20)22/h14-15,18-19H,10-13H2,1-9H3/t14-,15-,18+,19+/m1/s1 |
| InChIKey | UVIVQYIPENODOS-LTDCPUDJSA-N |
| XLogP | 3.54 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.78 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|