C21H36O4 — CID 91700371
1-O-[(2Z)-3,7-dimethylocta-2,6-dienyl] 4-O-heptan-2-yl butanedioate (PubChem CID 91700371) has the molecular formula C21H36O4 and a molecular weight of 352.52 g/mol. Its IUPAC name is 1-O-[(2Z)-3,7-dimethylocta-2,6-dienyl] 4-O-heptan-2-yl butanedioate.
| Compound Name | 1-O-[(2Z)-3,7-dimethylocta-2,6-dienyl] 4-O-heptan-2-yl butanedioate |
|---|---|
| PubChem CID | 91700371 |
| Molecular Formula | C21H36O4 |
| Molecular Weight | 352.52 g/mol |
| Exact Mass | 352.26 |
| IUPAC Name | 1-O-[(2Z)-3,7-dimethylocta-2,6-dienyl] 4-O-heptan-2-yl butanedioate |
| SMILES | CCCCCC(C)OC(=O)CCC(=O)OC/C=C(/C)CCC=C(C)C |
| InChI | InChI=1S/C21H36O4/c1-6-7-8-12-19(5)25-21(23)14-13-20(22)24-16-15-18(4)11-9-10-17(2)3/h10,15,19H,6-9,11-14,16H2,1-5H3/b18-15- |
| InChIKey | UGZADRPOGUMZED-SDXDJHTJSA-N |
| XLogP | 5.51 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.52 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|