C24H40O4 — CID 91700483
5-O-(1-cyclohex-2-en-1-ylhexan-3-yl) 1-O-(cyclohexylmethyl) pentanedioate (PubChem CID 91700483) has the molecular formula C24H40O4 and a molecular weight of 392.58 g/mol. Its IUPAC name is 5-O-(1-cyclohex-2-en-1-ylhexan-3-yl) 1-O-(cyclohexylmethyl) pentanedioate.
| Compound Name | 5-O-(1-cyclohex-2-en-1-ylhexan-3-yl) 1-O-(cyclohexylmethyl) pentanedioate |
|---|---|
| PubChem CID | 91700483 |
| Molecular Formula | C24H40O4 |
| Molecular Weight | 392.58 g/mol |
| Exact Mass | 392.29 |
| IUPAC Name | 5-O-(1-cyclohex-2-en-1-ylhexan-3-yl) 1-O-(cyclohexylmethyl) pentanedioate |
| SMILES | CCCC(CCC1C=CCCC1)OC(=O)CCCC(=O)OCC1CCCCC1 |
| InChI | InChI=1S/C24H40O4/c1-2-10-22(18-17-20-11-5-3-6-12-20)28-24(26)16-9-15-23(25)27-19-21-13-7-4-8-14-21/h5,11,20-22H,2-4,6-10,12-19H2,1H3 |
| InChIKey | GUDZARSKLUBCKR-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.58 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|