C22H21ClFN2O2+ — CID 9172073
[2-(2-chloro-4-fluoroanilino)-2-oxoethyl]-[(S)-(4-methoxyphenyl)-phenylmethyl]azanium (PubChem CID 9172073) has the molecular formula C22H21ClFN2O2+ and a molecular weight of 399.87 g/mol. Its IUPAC name is [2-(2-chloro-4-fluoroanilino)-2-oxoethyl]-[(S)-(4-methoxyphenyl)-phenylmethyl]azanium.
| Compound Name | [2-(2-chloro-4-fluoroanilino)-2-oxoethyl]-[(S)-(4-methoxyphenyl)-phenylmethyl]azanium |
|---|---|
| PubChem CID | 9172073 |
| Molecular Formula | C22H21ClFN2O2+ |
| Molecular Weight | 399.87 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | [2-(2-chloro-4-fluoroanilino)-2-oxoethyl]-[(S)-(4-methoxyphenyl)-phenylmethyl]azanium |
| SMILES | COc1ccc([C@@H]([NH2+]CC(=O)Nc2ccc(F)cc2Cl)c2ccccc2)cc1 |
| InChI | InChI=1S/C22H20ClFN2O2/c1-28-18-10-7-16(8-11-18)22(15-5-3-2-4-6-15)25-14-21(27)26-20-12-9-17(24)13-19(20)23/h2-13,22,25H,14H2,1H3,(H,26,27)/p+1/t22-/m0/s1 |
| InChIKey | QMVGOEGCICYEAD-QFIPXVFZSA-O |
| XLogP | 3.78 |
| TPSA | 54.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.87 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |