C15H27N — CID 91721008
(6Z)-8-methyl-6-(2-methylpentylidene)-2,3,5,7,8,8a-hexahydro-1H-indolizine (PubChem CID 91721008) has the molecular formula C15H27N and a molecular weight of 221.39 g/mol. Its IUPAC name is (6Z)-8-methyl-6-(2-methylpentylidene)-2,3,5,7,8,8a-hexahydro-1H-indolizine.
| Compound Name | (6Z)-8-methyl-6-(2-methylpentylidene)-2,3,5,7,8,8a-hexahydro-1H-indolizine |
|---|---|
| PubChem CID | 91721008 |
| Molecular Formula | C15H27N |
| Molecular Weight | 221.39 g/mol |
| Exact Mass | 221.21 |
| IUPAC Name | (6Z)-8-methyl-6-(2-methylpentylidene)-2,3,5,7,8,8a-hexahydro-1H-indolizine |
| SMILES | CCCC(C)/C=C1/CC(C)C2CCCN2C1 |
| InChI | InChI=1S/C15H27N/c1-4-6-12(2)9-14-10-13(3)15-7-5-8-16(15)11-14/h9,12-13,15H,4-8,10-11H2,1-3H3/b14-9- |
| InChIKey | OZAROULQGKOSBQ-ZROIWOOFSA-N |
| XLogP | 3.85 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.39 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|