C18H15IO2 — CID 91737295
2-iodoethyl 2,3-diphenylcycloprop-2-ene-1-carboxylate (PubChem CID 91737295) has the molecular formula C18H15IO2 and a molecular weight of 390.22 g/mol. Its IUPAC name is 2-iodoethyl 2,3-diphenylcycloprop-2-ene-1-carboxylate.
| Compound Name | 2-iodoethyl 2,3-diphenylcycloprop-2-ene-1-carboxylate |
|---|---|
| PubChem CID | 91737295 |
| Molecular Formula | C18H15IO2 |
| Molecular Weight | 390.22 g/mol |
| Exact Mass | 390.01 |
| IUPAC Name | 2-iodoethyl 2,3-diphenylcycloprop-2-ene-1-carboxylate |
| SMILES | O=C(OCCI)C1C(c2ccccc2)=C1c1ccccc1 |
| InChI | InChI=1S/C18H15IO2/c19-11-12-21-18(20)17-15(13-7-3-1-4-8-13)16(17)14-9-5-2-6-10-14/h1-10,17H,11-12H2 |
| InChIKey | OBRMXVMQUCJSJM-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.22 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|