C15H32N4O2Si2 — CID 91741562
4,6-bis[[tert-butyl(dimethyl)silyl]oxy]-1,3,5-triazin-2-amine (PubChem CID 91741562) has the molecular formula C15H32N4O2Si2 and a molecular weight of 356.62 g/mol. Its IUPAC name is 4,6-bis[[tert-butyl(dimethyl)silyl]oxy]-1,3,5-triazin-2-amine.
| Compound Name | 4,6-bis[[tert-butyl(dimethyl)silyl]oxy]-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 91741562 |
| Molecular Formula | C15H32N4O2Si2 |
| Molecular Weight | 356.62 g/mol |
| Exact Mass | 356.21 |
| IUPAC Name | 4,6-bis[[tert-butyl(dimethyl)silyl]oxy]-1,3,5-triazin-2-amine |
| SMILES | CC(C)(C)[Si](C)(C)Oc1nc(N)nc(O[Si](C)(C)C(C)(C)C)n1 |
| InChI | InChI=1S/C15H32N4O2Si2/c1-14(2,3)22(7,8)20-12-17-11(16)18-13(19-12)21-23(9,10)15(4,5)6/h1-10H3,(H2,16,17,18,19) |
| InChIKey | YLIFTRQXKTZSBM-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 83.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.62 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|