C21H30F8O4 — CID 91742883
5-O-(2,2,3,3,4,4,5,5-octafluoropentyl) 1-O-[(E)-undec-2-enyl] pentanedioate (PubChem CID 91742883) has the molecular formula C21H30F8O4 and a molecular weight of 498.45 g/mol. Its IUPAC name is 5-O-(2,2,3,3,4,4,5,5-octafluoropentyl) 1-O-[(E)-undec-2-enyl] pentanedioate.
| Compound Name | 5-O-(2,2,3,3,4,4,5,5-octafluoropentyl) 1-O-[(E)-undec-2-enyl] pentanedioate |
|---|---|
| PubChem CID | 91742883 |
| Molecular Formula | C21H30F8O4 |
| Molecular Weight | 498.45 g/mol |
| Exact Mass | 498.20 |
| IUPAC Name | 5-O-(2,2,3,3,4,4,5,5-octafluoropentyl) 1-O-[(E)-undec-2-enyl] pentanedioate |
| SMILES | CCCCCCCC/C=C/COC(=O)CCCC(=O)OCC(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C21H30F8O4/c1-2-3-4-5-6-7-8-9-10-14-32-16(30)12-11-13-17(31)33-15-19(24,25)21(28,29)20(26,27)18(22)23/h9-10,18H,2-8,11-15H2,1H3/b10-9+ |
| InChIKey | DZARZFOLDSMPJA-MDZDMXLPSA-N |
| XLogP | 6.72 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.45 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|