C15H11F9N2O3 — CID 91749996
[4-[4-(2,2,2-trifluoroacetyl)piperazin-1-yl]-2-(trifluoromethyl)phenyl] 2,2,2-trifluoroacetate (PubChem CID 91749996) has the molecular formula C15H11F9N2O3 and a molecular weight of 438.25 g/mol. Its IUPAC name is [4-[4-(2,2,2-trifluoroacetyl)piperazin-1-yl]-2-(trifluoromethyl)phenyl] 2,2,2-trifluoroacetate.
| Compound Name | [4-[4-(2,2,2-trifluoroacetyl)piperazin-1-yl]-2-(trifluoromethyl)phenyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 91749996 |
| Molecular Formula | C15H11F9N2O3 |
| Molecular Weight | 438.25 g/mol |
| Exact Mass | 438.06 |
| IUPAC Name | [4-[4-(2,2,2-trifluoroacetyl)piperazin-1-yl]-2-(trifluoromethyl)phenyl] 2,2,2-trifluoroacetate |
| SMILES | O=C(Oc1ccc(N2CCN(C(=O)C(F)(F)F)CC2)cc1C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C15H11F9N2O3/c16-13(17,18)9-7-8(1-2-10(9)29-12(28)15(22,23)24)25-3-5-26(6-4-25)11(27)14(19,20)21/h1-2,7H,3-6H2 |
| InChIKey | FRQQAVKJHQNQJP-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.25 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|