C11H18O — CID 91753286
(6E,8E)-undeca-6,8-dien-2-one (PubChem CID 91753286) has the molecular formula C11H18O and a molecular weight of 166.26 g/mol. Its IUPAC name is (6E,8E)-undeca-6,8-dien-2-one.
| Compound Name | (6E,8E)-undeca-6,8-dien-2-one |
|---|---|
| PubChem CID | 91753286 |
| Molecular Formula | C11H18O |
| Molecular Weight | 166.26 g/mol |
| Exact Mass | 166.14 |
| IUPAC Name | (6E,8E)-undeca-6,8-dien-2-one |
| SMILES | CC/C=C/C=C/CCCC(C)=O |
| InChI | InChI=1S/C11H18O/c1-3-4-5-6-7-8-9-10-11(2)12/h4-7H,3,8-10H2,1-2H3/b5-4+,7-6+ |
| InChIKey | ITFIJUPFLFMZKL-YTXTXJHMSA-N |
| XLogP | 3.27 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.26 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|