C19H18NO+ — CID 91803021
4-cyclohexa-2,4-dien-1-yl-8-methyl-6H-pyrido[1,2-c][1,3]benzoxazin-7-ium (PubChem CID 91803021) has the molecular formula C19H18NO+ and a molecular weight of 276.36 g/mol. Its IUPAC name is 4-cyclohexa-2,4-dien-1-yl-8-methyl-6H-pyrido[1,2-c][1,3]benzoxazin-7-ium.
| Compound Name | 4-cyclohexa-2,4-dien-1-yl-8-methyl-6H-pyrido[1,2-c][1,3]benzoxazin-7-ium |
|---|---|
| PubChem CID | 91803021 |
| Molecular Formula | C19H18NO+ |
| Molecular Weight | 276.36 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | 4-cyclohexa-2,4-dien-1-yl-8-methyl-6H-pyrido[1,2-c][1,3]benzoxazin-7-ium |
| SMILES | Cc1cccc2[n+]1COc1c-2cccc1C1C=CC=CC1 |
| InChI | InChI=1S/C19H18NO/c1-14-7-5-12-18-17-11-6-10-16(15-8-3-2-4-9-15)19(17)21-13-20(14)18/h2-8,10-12,15H,9,13H2,1H3/q+1 |
| InChIKey | IPVSKYRVQMACEB-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 13.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.36 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|