C21H20 — CID 142749479
1,2-di(cyclohexa-2,4-dien-1-yl)-1H-indene (PubChem CID 142749479) has the molecular formula C21H20 and a molecular weight of 272.39 g/mol. Its IUPAC name is 1,2-di(cyclohexa-2,4-dien-1-yl)-1H-indene.
| Compound Name | 1,2-di(cyclohexa-2,4-dien-1-yl)-1H-indene |
|---|---|
| PubChem CID | 142749479 |
| Molecular Formula | C21H20 |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | 1,2-di(cyclohexa-2,4-dien-1-yl)-1H-indene |
| SMILES | C1=CCC(C2=Cc3ccccc3C2C2C=CC=CC2)C=C1 |
| InChI | InChI=1S/C21H20/c1-3-9-16(10-4-1)20-15-18-13-7-8-14-19(18)21(20)17-11-5-2-6-12-17/h1-9,11,13-17,21H,10,12H2 |
| InChIKey | ATVGPUCJFISYDM-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |