C19H16S — CID 155239563
9-cyclohexa-2,4-dien-1-yl-9H-thioxanthene (PubChem CID 155239563) has the molecular formula C19H16S and a molecular weight of 276.40 g/mol. Its IUPAC name is 9-cyclohexa-2,4-dien-1-yl-9H-thioxanthene.
| Compound Name | 9-cyclohexa-2,4-dien-1-yl-9H-thioxanthene |
|---|---|
| PubChem CID | 155239563 |
| Molecular Formula | C19H16S |
| Molecular Weight | 276.40 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | 9-cyclohexa-2,4-dien-1-yl-9H-thioxanthene |
| SMILES | C1=CCC(C2c3ccccc3Sc3ccccc32)C=C1 |
| InChI | InChI=1S/C19H16S/c1-2-8-14(9-3-1)19-15-10-4-6-12-17(15)20-18-13-7-5-11-16(18)19/h1-8,10-14,19H,9H2 |
| InChIKey | DKULUKAVMAREAF-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.40 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |