C10H16N2O2S2 — CID 91804318
5-(2,6-dimethylpiperidin-1-yl)sulfonyl-1,3-thiazole (PubChem CID 91804318) has the molecular formula C10H16N2O2S2 and a molecular weight of 260.38 g/mol. Its IUPAC name is 5-(2,6-dimethylpiperidin-1-yl)sulfonyl-1,3-thiazole.
| Compound Name | 5-(2,6-dimethylpiperidin-1-yl)sulfonyl-1,3-thiazole |
|---|---|
| PubChem CID | 91804318 |
| Molecular Formula | C10H16N2O2S2 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.07 |
| IUPAC Name | 5-(2,6-dimethylpiperidin-1-yl)sulfonyl-1,3-thiazole |
| SMILES | CC1CCCC(C)N1S(=O)(=O)c1cncs1 |
| InChI | InChI=1S/C10H16N2O2S2/c1-8-4-3-5-9(2)12(8)16(13,14)10-6-11-7-15-10/h6-9H,3-5H2,1-2H3 |
| InChIKey | PUEQQIFZLJTOIW-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |