C10H16F4 — CID 91807449
1,4-bis(1,2-difluoroethyl)cyclohexane (PubChem CID 91807449) has the molecular formula C10H16F4 and a molecular weight of 212.23 g/mol. Its IUPAC name is 1,4-bis(1,2-difluoroethyl)cyclohexane.
| Compound Name | 1,4-bis(1,2-difluoroethyl)cyclohexane |
|---|---|
| PubChem CID | 91807449 |
| Molecular Formula | C10H16F4 |
| Molecular Weight | 212.23 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | 1,4-bis(1,2-difluoroethyl)cyclohexane |
| SMILES | FCC(F)C1CCC(C(F)CF)CC1 |
| InChI | InChI=1S/C10H16F4/c11-5-9(13)7-1-2-8(4-3-7)10(14)6-12/h7-10H,1-6H2 |
| InChIKey | GBWIRIIXGBMPLM-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.23 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |