About 1,4-bis(1,2-difluoroethyl)cyclohexane
1,4-bis(1,2-difluoroethyl)cyclohexane (PubChem CID 91807449) has the molecular formula C10H16F4
and a molecular weight of 212.23 g/mol. Its IUPAC name is 1,4-bis(1,2-difluoroethyl)cyclohexane.
Molecular Properties
| Compound Name | 1,4-bis(1,2-difluoroethyl)cyclohexane |
| PubChem CID | 91807449 |
| Molecular Formula | C10H16F4 |
| Molecular Weight | 212.23 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | 1,4-bis(1,2-difluoroethyl)cyclohexane |
| SMILES | FCC(F)C1CCC(C(F)CF)CC1 |
| InChI | InChI=1S/C10H16F4/c11-5-9(13)7-1-2-8(4-3-7)10(14)6-12/h7-10H,1-6H2 |
| InChIKey | GBWIRIIXGBMPLM-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.23 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1,4-bis(1,2-difluoroethyl)cyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-bis(1,2-difluoroethyl)cyclohexane?
The IUPAC name of 1,4-bis(1,2-difluoroethyl)cyclohexane (CID 91807449) is 1,4-bis(1,2-difluoroethyl)cyclohexane.
What is the SMILES notation for 1,4-bis(1,2-difluoroethyl)cyclohexane?
The canonical SMILES for 1,4-bis(1,2-difluoroethyl)cyclohexane is FCC(F)C1CCC(C(F)CF)CC1.
What is the InChIKey of 1,4-bis(1,2-difluoroethyl)cyclohexane?
The InChIKey is GBWIRIIXGBMPLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16F4/c11-5-9(13)7-1-2-8(4-3-7)10(14)6-12/h7-10H,1-6H2.
What are the key properties of 1,4-bis(1,2-difluoroethyl)cyclohexane?
1,4-bis(1,2-difluoroethyl)cyclohexane has a molecular weight of 212.23 g/mol, XLogP of 3.41, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-bis(1,2-difluoroethyl)cyclohexane is sourced from PubChem (CID 91807449), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).