C18H18ClF3N4O2 — CID 91809991
5-chloro-2-methoxy-N-[1-[6-(trifluoromethyl)pyrimidin-4-yl]piperidin-4-yl]benzamide (PubChem CID 91809991) has the molecular formula C18H18ClF3N4O2 and a molecular weight of 414.82 g/mol. Its IUPAC name is 5-chloro-2-methoxy-N-[1-[6-(trifluoromethyl)pyrimidin-4-yl]piperidin-4-yl]benzamide.
| Compound Name | 5-chloro-2-methoxy-N-[1-[6-(trifluoromethyl)pyrimidin-4-yl]piperidin-4-yl]benzamide |
|---|---|
| PubChem CID | 91809991 |
| Molecular Formula | C18H18ClF3N4O2 |
| Molecular Weight | 414.82 g/mol |
| Exact Mass | 414.11 |
| IUPAC Name | 5-chloro-2-methoxy-N-[1-[6-(trifluoromethyl)pyrimidin-4-yl]piperidin-4-yl]benzamide |
| SMILES | COc1ccc(Cl)cc1C(=O)NC1CCN(c2cc(C(F)(F)F)ncn2)CC1 |
| InChI | InChI=1S/C18H18ClF3N4O2/c1-28-14-3-2-11(19)8-13(14)17(27)25-12-4-6-26(7-5-12)16-9-15(18(20,21)22)23-10-24-16/h2-3,8-10,12H,4-7H2,1H3,(H,25,27) |
| InChIKey | DXMURFXROIHGSX-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.82 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |