C19H20N4O3 — CID 9182098
2-(1,4-dioxo-3H-phthalazin-2-yl)-N'-ethyl-N'-(4-methylphenyl)acetohydrazide (PubChem CID 9182098) has the molecular formula C19H20N4O3 and a molecular weight of 352.39 g/mol. Its IUPAC name is 2-(1,4-dioxo-3H-phthalazin-2-yl)-N'-ethyl-N'-(4-methylphenyl)acetohydrazide.
| Compound Name | 2-(1,4-dioxo-3H-phthalazin-2-yl)-N'-ethyl-N'-(4-methylphenyl)acetohydrazide |
|---|---|
| PubChem CID | 9182098 |
| Molecular Formula | C19H20N4O3 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | 2-(1,4-dioxo-3H-phthalazin-2-yl)-N'-ethyl-N'-(4-methylphenyl)acetohydrazide |
| SMILES | CCN(NC(=O)Cn1[nH]c(=O)c2ccccc2c1=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C19H20N4O3/c1-3-22(14-10-8-13(2)9-11-14)20-17(24)12-23-19(26)16-7-5-4-6-15(16)18(25)21-23/h4-11H,3,12H2,1-2H3,(H,20,24)(H,21,25) |
| InChIKey | UAARCLXTAHLVHC-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 87.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|