C16H16ClNO5S2 — CID 9183669
N-[(2R)-2-(1,3-benzodioxol-5-yl)-2-thiophen-2-ylsulfonylethyl]-3-chloropropanamide (PubChem CID 9183669) has the molecular formula C16H16ClNO5S2 and a molecular weight of 401.89 g/mol. Its IUPAC name is N-[(2R)-2-(1,3-benzodioxol-5-yl)-2-thiophen-2-ylsulfonylethyl]-3-chloropropanamide.
| Compound Name | N-[(2R)-2-(1,3-benzodioxol-5-yl)-2-thiophen-2-ylsulfonylethyl]-3-chloropropanamide |
|---|---|
| PubChem CID | 9183669 |
| Molecular Formula | C16H16ClNO5S2 |
| Molecular Weight | 401.89 g/mol |
| Exact Mass | 401.02 |
| IUPAC Name | N-[(2R)-2-(1,3-benzodioxol-5-yl)-2-thiophen-2-ylsulfonylethyl]-3-chloropropanamide |
| SMILES | O=C(CCCl)NC[C@@H](c1ccc2c(c1)OCO2)S(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C16H16ClNO5S2/c17-6-5-15(19)18-9-14(25(20,21)16-2-1-7-24-16)11-3-4-12-13(8-11)23-10-22-12/h1-4,7-8,14H,5-6,9-10H2,(H,18,19)/t14-/m0/s1 |
| InChIKey | IOZQBCCMSUMAJO-AWEZNQCLSA-N |
| XLogP | 2.74 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.89 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|