C15H21N3O3 — CID 91838139
3-[2-[2-(3-methoxyphenoxy)ethyl-methylamino]ethyl]-1H-imidazol-2-one (PubChem CID 91838139) has the molecular formula C15H21N3O3 and a molecular weight of 291.35 g/mol. Its IUPAC name is 3-[2-[2-(3-methoxyphenoxy)ethyl-methylamino]ethyl]-1H-imidazol-2-one.
| Compound Name | 3-[2-[2-(3-methoxyphenoxy)ethyl-methylamino]ethyl]-1H-imidazol-2-one |
|---|---|
| PubChem CID | 91838139 |
| Molecular Formula | C15H21N3O3 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | 3-[2-[2-(3-methoxyphenoxy)ethyl-methylamino]ethyl]-1H-imidazol-2-one |
| SMILES | COc1cccc(OCCN(C)CCn2cc[nH]c2=O)c1 |
| InChI | InChI=1S/C15H21N3O3/c1-17(8-9-18-7-6-16-15(18)19)10-11-21-14-5-3-4-13(12-14)20-2/h3-7,12H,8-11H2,1-2H3,(H,16,19) |
| InChIKey | YYRMXALVWYKHDU-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 59.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |