About 2-butyl-6-ethylpyrazine
2-butyl-6-ethylpyrazine (PubChem CID 91862985) has the molecular formula C10H16N2
and a molecular weight of 164.25 g/mol. Its IUPAC name is 2-butyl-6-ethylpyrazine.
Molecular Properties
| Compound Name | 2-butyl-6-ethylpyrazine |
| PubChem CID | 91862985 |
| Molecular Formula | C10H16N2 |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.13 |
| IUPAC Name | 2-butyl-6-ethylpyrazine |
| SMILES | CCCCc1cncc(CC)n1 |
| InChI | InChI=1S/C10H16N2/c1-3-5-6-10-8-11-7-9(4-2)12-10/h7-8H,3-6H2,1-2H3 |
| InChIKey | SWXKPVFHMXCWTM-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-butyl-6-ethylpyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butyl-6-ethylpyrazine?
The IUPAC name of 2-butyl-6-ethylpyrazine (CID 91862985) is 2-butyl-6-ethylpyrazine.
What is the SMILES notation for 2-butyl-6-ethylpyrazine?
The canonical SMILES for 2-butyl-6-ethylpyrazine is CCCCc1cncc(CC)n1.
What is the InChIKey of 2-butyl-6-ethylpyrazine?
The InChIKey is SWXKPVFHMXCWTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2/c1-3-5-6-10-8-11-7-9(4-2)12-10/h7-8H,3-6H2,1-2H3.
What are the key properties of 2-butyl-6-ethylpyrazine?
2-butyl-6-ethylpyrazine has a molecular weight of 164.25 g/mol, XLogP of 2.38, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butyl-6-ethylpyrazine is sourced from PubChem (CID 91862985), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).