C14H24N2O5 — CID 57092020
(1S,2R,3S,4R)-1-(6-pentylpyrazin-2-yl)pentane-1,2,3,4,5-pentol (PubChem CID 57092020) has the molecular formula C14H24N2O5 and a molecular weight of 300.36 g/mol. Its IUPAC name is (1S,2R,3S,4R)-1-(6-pentylpyrazin-2-yl)pentane-1,2,3,4,5-pentol.
| Compound Name | (1S,2R,3S,4R)-1-(6-pentylpyrazin-2-yl)pentane-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 57092020 |
| Molecular Formula | C14H24N2O5 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.17 |
| IUPAC Name | (1S,2R,3S,4R)-1-(6-pentylpyrazin-2-yl)pentane-1,2,3,4,5-pentol |
| SMILES | CCCCCc1cncc([C@H](O)[C@@H](O)[C@@H](O)[C@H](O)CO)n1 |
| InChI | InChI=1S/C14H24N2O5/c1-2-3-4-5-9-6-15-7-10(16-9)12(19)14(21)13(20)11(18)8-17/h6-7,11-14,17-21H,2-5,8H2,1H3/t11-,12+,13+,14-/m1/s1 |
| InChIKey | FMZPZHVITBNYFW-ZOBORPQBSA-N |
| XLogP | -0.68 |
| TPSA | 126.93 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|