C14H24N2O9 — CID 67556506
(1S,2S,3S,4R)-1-[5-[(2S,3R,4R)-2,3,4,5-tetrahydroxypentyl]pyrazin-2-yl]pentane-1,2,3,4,5-pentol (PubChem CID 67556506) has the molecular formula C14H24N2O9 and a molecular weight of 364.35 g/mol. Its IUPAC name is (1S,2S,3S,4R)-1-[5-[(2S,3R,4R)-2,3,4,5-tetrahydroxypentyl]pyrazin-2-yl]pentane-1,2,3,4,5-pentol.
| Compound Name | (1S,2S,3S,4R)-1-[5-[(2S,3R,4R)-2,3,4,5-tetrahydroxypentyl]pyrazin-2-yl]pentane-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 67556506 |
| Molecular Formula | C14H24N2O9 |
| Molecular Weight | 364.35 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | (1S,2S,3S,4R)-1-[5-[(2S,3R,4R)-2,3,4,5-tetrahydroxypentyl]pyrazin-2-yl]pentane-1,2,3,4,5-pentol |
| SMILES | OC[C@@H](O)[C@H](O)[C@@H](O)[C@@H](O)c1cnc(C[C@H](O)[C@@H](O)[C@H](O)CO)cn1 |
| InChI | InChI=1S/C14H24N2O9/c17-4-9(20)12(23)8(19)1-6-2-16-7(3-15-6)11(22)14(25)13(24)10(21)5-18/h2-3,8-14,17-25H,1,4-5H2/t8-,9+,10+,11-,12+,13-,14-/m0/s1 |
| InChIKey | SZSWJMKSAIRZRM-QSAXWINLSA-N |
| XLogP | -4.80 |
| TPSA | 207.85 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.35 |
| LogP ≤ 5 | -4.80 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 11 |