C18H18ClNO5 — CID 9188020
4-[(E)-3-(3-chloro-5-ethoxy-4-hydroxyphenyl)prop-2-enoyl]-3,5-dimethyl-1H-pyrrole-2-carboxylic acid (PubChem CID 9188020) has the molecular formula C18H18ClNO5 and a molecular weight of 363.80 g/mol. Its IUPAC name is 4-[(E)-3-(3-chloro-5-ethoxy-4-hydroxyphenyl)prop-2-enoyl]-3,5-dimethyl-1H-pyrrole-2-carboxylic acid.
| Compound Name | 4-[(E)-3-(3-chloro-5-ethoxy-4-hydroxyphenyl)prop-2-enoyl]-3,5-dimethyl-1H-pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 9188020 |
| Molecular Formula | C18H18ClNO5 |
| Molecular Weight | 363.80 g/mol |
| Exact Mass | 363.09 |
| IUPAC Name | 4-[(E)-3-(3-chloro-5-ethoxy-4-hydroxyphenyl)prop-2-enoyl]-3,5-dimethyl-1H-pyrrole-2-carboxylic acid |
| SMILES | CCOc1cc(/C=C/C(=O)c2c(C)[nH]c(C(=O)O)c2C)cc(Cl)c1O |
| InChI | InChI=1S/C18H18ClNO5/c1-4-25-14-8-11(7-12(19)17(14)22)5-6-13(21)15-9(2)16(18(23)24)20-10(15)3/h5-8,20,22H,4H2,1-3H3,(H,23,24)/b6-5+ |
| InChIKey | RHQYNCICFQFDEC-AATRIKPKSA-N |
| XLogP | 3.98 |
| TPSA | 99.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.80 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|