C9H14N4OS — CID 91927102
1-methyl-3-(2-pyrrolidin-1-yl-1,3-thiazol-4-yl)urea (PubChem CID 91927102) has the molecular formula C9H14N4OS and a molecular weight of 226.30 g/mol. Its IUPAC name is 1-methyl-3-(2-pyrrolidin-1-yl-1,3-thiazol-4-yl)urea.
| Compound Name | 1-methyl-3-(2-pyrrolidin-1-yl-1,3-thiazol-4-yl)urea |
|---|---|
| PubChem CID | 91927102 |
| Molecular Formula | C9H14N4OS |
| Molecular Weight | 226.30 g/mol |
| Exact Mass | 226.09 |
| IUPAC Name | 1-methyl-3-(2-pyrrolidin-1-yl-1,3-thiazol-4-yl)urea |
| SMILES | CNC(=O)Nc1csc(N2CCCC2)n1 |
| InChI | InChI=1S/C9H14N4OS/c1-10-8(14)11-7-6-15-9(12-7)13-4-2-3-5-13/h6H,2-5H2,1H3,(H2,10,11,14) |
| InChIKey | DQJXCMGEKMNAJS-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.30 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |