C19H23NO7 — CID 91932950
N-cyclopropyl-2-methyl-3,5-dioxo-4-[(3,4,5-trimethoxyphenyl)methyl]oxolane-2-carboxamide (PubChem CID 91932950) has the molecular formula C19H23NO7 and a molecular weight of 377.39 g/mol. Its IUPAC name is N-cyclopropyl-2-methyl-3,5-dioxo-4-[(3,4,5-trimethoxyphenyl)methyl]oxolane-2-carboxamide.
| Compound Name | N-cyclopropyl-2-methyl-3,5-dioxo-4-[(3,4,5-trimethoxyphenyl)methyl]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 91932950 |
| Molecular Formula | C19H23NO7 |
| Molecular Weight | 377.39 g/mol |
| Exact Mass | 377.15 |
| IUPAC Name | N-cyclopropyl-2-methyl-3,5-dioxo-4-[(3,4,5-trimethoxyphenyl)methyl]oxolane-2-carboxamide |
| SMILES | COc1cc(CC2C(=O)OC(C)(C(=O)NC3CC3)C2=O)cc(OC)c1OC |
| InChI | InChI=1S/C19H23NO7/c1-19(18(23)20-11-5-6-11)16(21)12(17(22)27-19)7-10-8-13(24-2)15(26-4)14(9-10)25-3/h8-9,11-12H,5-7H2,1-4H3,(H,20,23) |
| InChIKey | XUYAYEVZAROZTL-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.39 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|