C13H22N4O3 — CID 91933455
1,3-dibutyl-2,4,6-trioxo-1,3-diazinane-5-carboximidamide (PubChem CID 91933455) has the molecular formula C13H22N4O3 and a molecular weight of 282.34 g/mol. Its IUPAC name is 1,3-dibutyl-2,4,6-trioxo-1,3-diazinane-5-carboximidamide.
| Compound Name | 1,3-dibutyl-2,4,6-trioxo-1,3-diazinane-5-carboximidamide |
|---|---|
| PubChem CID | 91933455 |
| Molecular Formula | C13H22N4O3 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | 1,3-dibutyl-2,4,6-trioxo-1,3-diazinane-5-carboximidamide |
| SMILES | [H]/N=C(\N)C1C(=O)N(CCCC)C(=O)N(CCCC)C1=O |
| InChI | InChI=1S/C13H22N4O3/c1-3-5-7-16-11(18)9(10(14)15)12(19)17(13(16)20)8-6-4-2/h9H,3-8H2,1-2H3,(H3,14,15) |
| InChIKey | GFVMKTXDKGEGKN-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 107.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|