C14H25N4O3+ — CID 7368043
3-[[(5R)-1-butyl-2,4,6-trioxo-1,3-diazinan-5-yl]methylideneamino]propyl-dimethylazanium (PubChem CID 7368043) has the molecular formula C14H25N4O3+ and a molecular weight of 297.38 g/mol. Its IUPAC name is 3-[[(5R)-1-butyl-2,4,6-trioxo-1,3-diazinan-5-yl]methylideneamino]propyl-dimethylazanium.
| Compound Name | 3-[[(5R)-1-butyl-2,4,6-trioxo-1,3-diazinan-5-yl]methylideneamino]propyl-dimethylazanium |
|---|---|
| PubChem CID | 7368043 |
| Molecular Formula | C14H25N4O3+ |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.19 |
| IUPAC Name | 3-[[(5R)-1-butyl-2,4,6-trioxo-1,3-diazinan-5-yl]methylideneamino]propyl-dimethylazanium |
| SMILES | CCCCN1C(=O)NC(=O)[C@@H](/C=N/CCC[NH+](C)C)C1=O |
| InChI | InChI=1S/C14H24N4O3/c1-4-5-9-18-13(20)11(12(19)16-14(18)21)10-15-7-6-8-17(2)3/h10-11H,4-9H2,1-3H3,(H,16,19,21)/p+1/b15-10+/t11-/m1/s1 |
| InChIKey | JPICMHQQWRPVBH-HGLKBHAMSA-O |
| XLogP | -0.91 |
| TPSA | 83.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|