C29H36N6O3 — CID 91934567
2-[3-[4-hydroxy-2-oxo-3-[(2R)-1-oxo-3-phenyl-1-spiro[1,2-dihydroindene-3,4'-piperidine]-1'-ylpropan-2-yl]-1H-imidazol-5-yl]propyl]guanidine (PubChem CID 91934567) has the molecular formula C29H36N6O3 and a molecular weight of 516.65 g/mol. Its IUPAC name is 2-[3-[4-hydroxy-2-oxo-3-[(2R)-1-oxo-3-phenyl-1-spiro[1,2-dihydroindene-3,4'-piperidine]-1'-ylpropan-2-yl]-1H-imidazol-5-yl]propyl]guanidine.
| Compound Name | 2-[3-[4-hydroxy-2-oxo-3-[(2R)-1-oxo-3-phenyl-1-spiro[1,2-dihydroindene-3,4'-piperidine]-1'-ylpropan-2-yl]-1H-imidazol-5-yl]propyl]guanidine |
|---|---|
| PubChem CID | 91934567 |
| Molecular Formula | C29H36N6O3 |
| Molecular Weight | 516.65 g/mol |
| Exact Mass | 516.28 |
| IUPAC Name | 2-[3-[4-hydroxy-2-oxo-3-[(2R)-1-oxo-3-phenyl-1-spiro[1,2-dihydroindene-3,4'-piperidine]-1'-ylpropan-2-yl]-1H-imidazol-5-yl]propyl]guanidine |
| SMILES | NC(N)=NCCCc1[nH]c(=O)n([C@H](Cc2ccccc2)C(=O)N2CCC3(CCc4ccccc43)CC2)c1O |
| InChI | InChI=1S/C29H36N6O3/c30-27(31)32-16-6-11-23-25(36)35(28(38)33-23)24(19-20-7-2-1-3-8-20)26(37)34-17-14-29(15-18-34)13-12-21-9-4-5-10-22(21)29/h1-5,7-10,24,36H,6,11-19H2,(H,33,38)(H4,30,31,32)/t24-/m1/s1 |
| InChIKey | SBJUJMWAROQRQA-XMMPIXPASA-N |
| XLogP | 2.38 |
| TPSA | 142.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.65 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|