C30H38N6O3 — CID 91934571
2-[3-[4-hydroxy-2-oxo-3-(1-oxo-4-phenyl-1-spiro[1,2-dihydroindene-3,4'-piperidine]-1'-ylbutan-2-yl)-1H-imidazol-5-yl]propyl]guanidine (PubChem CID 91934571) has the molecular formula C30H38N6O3 and a molecular weight of 530.67 g/mol. Its IUPAC name is 2-[3-[4-hydroxy-2-oxo-3-(1-oxo-4-phenyl-1-spiro[1,2-dihydroindene-3,4'-piperidine]-1'-ylbutan-2-yl)-1H-imidazol-5-yl]propyl]guanidine.
| Compound Name | 2-[3-[4-hydroxy-2-oxo-3-(1-oxo-4-phenyl-1-spiro[1,2-dihydroindene-3,4'-piperidine]-1'-ylbutan-2-yl)-1H-imidazol-5-yl]propyl]guanidine |
|---|---|
| PubChem CID | 91934571 |
| Molecular Formula | C30H38N6O3 |
| Molecular Weight | 530.67 g/mol |
| Exact Mass | 530.30 |
| IUPAC Name | 2-[3-[4-hydroxy-2-oxo-3-(1-oxo-4-phenyl-1-spiro[1,2-dihydroindene-3,4'-piperidine]-1'-ylbutan-2-yl)-1H-imidazol-5-yl]propyl]guanidine |
| SMILES | NC(N)=NCCCc1[nH]c(=O)n(C(CCc2ccccc2)C(=O)N2CCC3(CCc4ccccc43)CC2)c1O |
| InChI | InChI=1S/C30H38N6O3/c31-28(32)33-18-6-11-24-26(37)36(29(39)34-24)25(13-12-21-7-2-1-3-8-21)27(38)35-19-16-30(17-20-35)15-14-22-9-4-5-10-23(22)30/h1-5,7-10,25,37H,6,11-20H2,(H,34,39)(H4,31,32,33) |
| InChIKey | WGDFSIVCQJLQOD-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 142.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.67 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|