C26H38N6O3 — CID 56658522
2-[3-[(4R)-1-[(2R,3R)-3-methyl-1-oxo-1-spiro[1,2-dihydroindene-3,4'-piperidine]-1'-ylpentan-2-yl]-2,5-dioxoimidazolidin-4-yl]propyl]guanidine (PubChem CID 56658522) has the molecular formula C26H38N6O3 and a molecular weight of 482.63 g/mol. Its IUPAC name is 2-[3-[(4R)-1-[(2R,3R)-3-methyl-1-oxo-1-spiro[1,2-dihydroindene-3,4'-piperidine]-1'-ylpentan-2-yl]-2,5-dioxoimidazolidin-4-yl]propyl]guanidine.
| Compound Name | 2-[3-[(4R)-1-[(2R,3R)-3-methyl-1-oxo-1-spiro[1,2-dihydroindene-3,4'-piperidine]-1'-ylpentan-2-yl]-2,5-dioxoimidazolidin-4-yl]propyl]guanidine |
|---|---|
| PubChem CID | 56658522 |
| Molecular Formula | C26H38N6O3 |
| Molecular Weight | 482.63 g/mol |
| Exact Mass | 482.30 |
| IUPAC Name | 2-[3-[(4R)-1-[(2R,3R)-3-methyl-1-oxo-1-spiro[1,2-dihydroindene-3,4'-piperidine]-1'-ylpentan-2-yl]-2,5-dioxoimidazolidin-4-yl]propyl]guanidine |
| SMILES | CC[C@@H](C)[C@H](C(=O)N1CCC2(CCc3ccccc32)CC1)N1C(=O)N[C@H](CCCN=C(N)N)C1=O |
| InChI | InChI=1S/C26H38N6O3/c1-3-17(2)21(32-22(33)20(30-25(32)35)9-6-14-29-24(27)28)23(34)31-15-12-26(13-16-31)11-10-18-7-4-5-8-19(18)26/h4-5,7-8,17,20-21H,3,6,9-16H2,1-2H3,(H,30,35)(H4,27,28,29)/t17-,20-,21-/m1/s1 |
| InChIKey | LILZPTSNASXJOE-DUXKGJEZSA-N |
| XLogP | 1.88 |
| TPSA | 134.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.63 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|