C17H21FN2O4S — CID 91939962
2-[(4aS,7aR)-1-[3-(4-fluorophenyl)prop-2-enyl]-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]acetic acid (PubChem CID 91939962) has the molecular formula C17H21FN2O4S and a molecular weight of 368.43 g/mol. Its IUPAC name is 2-[(4aS,7aR)-1-[3-(4-fluorophenyl)prop-2-enyl]-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]acetic acid.
| Compound Name | 2-[(4aS,7aR)-1-[3-(4-fluorophenyl)prop-2-enyl]-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]acetic acid |
|---|---|
| PubChem CID | 91939962 |
| Molecular Formula | C17H21FN2O4S |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.12 |
| IUPAC Name | 2-[(4aS,7aR)-1-[3-(4-fluorophenyl)prop-2-enyl]-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]acetic acid |
| SMILES | O=C(O)CN1CCN(CC=Cc2ccc(F)cc2)[C@H]2CS(=O)(=O)C[C@H]21 |
| InChI | InChI=1S/C17H21FN2O4S/c18-14-5-3-13(4-6-14)2-1-7-19-8-9-20(10-17(21)22)16-12-25(23,24)11-15(16)19/h1-6,15-16H,7-12H2,(H,21,22)/t15-,16+/m0/s1 |
| InChIKey | MRGYJQMYXFBEAZ-JKSUJKDBSA-N |
| XLogP | 0.71 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |